| Name | n-Nonanoyl Chloride |
| Synonyms | NNCL Nonanoylchlorid Nonanoyl Chloride NONANOYL CHLORIDE NONYL ACID CHLORIDE n-Nonanoyl Chloride N-NONANOYL CHLORIDE PELARGONYL CHLORIDE PELARGONOYL CHLORIDE Chlorure de nonanoyle Nonanoic acid chloride PELARGONIC ACID CHLORIDE |
| CAS | 764-85-2 |
| EINECS | 212-131-2 |
| InChI | InChI=1/C9H17ClO/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3 |
| Molecular Formula | C9H17ClO |
| Molar Mass | 176.68 |
| Density | 0.98 g/mL at 25 °C (lit.) |
| Melting Point | -60.5 °C |
| Boling Point | 108-110 °C/22 mmHg (lit.) |
| Flash Point | 203°F |
| Water Solubility | Reacts with water. |
| Vapor Presure | 0.2 hPa (20 °C) |
| Appearance | clear liquid |
| Color | Colorless to Light yellow |
| BRN | 1362621 |
| Storage Condition | Store below +30°C. |
| Sensitive | Moisture Sensitive |
| Explosive Limit | 0.8-3.7%(V) |
| Refractive Index | n20/D 1.438(lit.) |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R14 - Reacts violently with water R34 - Causes burns R37 - Irritating to the respiratory system |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 9-19-21 |
| TSCA | Yes |
| HS Code | 2915 90 70 |
| Hazard Class | 8 |
| Packing Group | II |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| autoignition temperature | 225°C |